C17H17N3O2S — CID 91639467
N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-thiophen-3-yl-1H-pyrazole-5-carboxamide (PubChem CID 91639467) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-thiophen-3-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-thiophen-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 91639467 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-3-thiophen-3-yl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)c1cc(-c2ccsc2)n[nH]1 |
| InChI | InChI=1S/C17H17N3O2S/c21-10-14(8-12-4-2-1-3-5-12)18-17(22)16-9-15(19-20-16)13-6-7-23-11-13/h1-7,9,11,14,21H,8,10H2,(H,18,22)(H,19,20)/t14-/m0/s1 |
| InChIKey | OVDRRRBWUWHRSU-AWEZNQCLSA-N |
| XLogP | 2.47 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |