C21H22N2O3S — CID 91640647
(2S)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 91640647) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is (2S)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 91640647 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2S)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc2ccn(Cc3ccccc3)c2c1)C(=O)O |
| InChI | InChI=1S/C21H22N2O3S/c1-27-12-10-18(21(25)26)22-20(24)17-8-7-16-9-11-23(19(16)13-17)14-15-5-3-2-4-6-15/h2-9,11,13,18H,10,12,14H2,1H3,(H,22,24)(H,25,26)/t18-/m0/s1 |
| InChIKey | QLDJQFPSPVIJQG-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |