C22H24N2O3S — CID 124661572
methyl (2R)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoate (PubChem CID 124661572) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is methyl (2R)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 124661572 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl (2R)-2-[(1-benzylindole-6-carbonyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@@H](CCSC)NC(=O)c1ccc2ccn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-27-22(26)19(11-13-28-2)23-21(25)18-9-8-17-10-12-24(20(17)14-18)15-16-6-4-3-5-7-16/h3-10,12,14,19H,11,13,15H2,1-2H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | IBGQXFHOMCAGLA-LJQANCHMSA-N |
| XLogP | 3.71 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |