C19H25N3O3S — CID 91642151
3-cyclohexyl-N'-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]propanehydrazide (PubChem CID 91642151) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-cyclohexyl-N'-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]propanehydrazide.
| Compound Name | 3-cyclohexyl-N'-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 91642151 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-cyclohexyl-N'-[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]propanehydrazide |
| SMILES | Cc1ccc(-c2nc(CC(=O)NNC(=O)CCC3CCCCC3)cs2)o1 |
| InChI | InChI=1S/C19H25N3O3S/c1-13-7-9-16(25-13)19-20-15(12-26-19)11-18(24)22-21-17(23)10-8-14-5-3-2-4-6-14/h7,9,12,14H,2-6,8,10-11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | DZAFEVNYSYJUHK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|