C19H26N2O3S — CID 55724268
N-[2-(2-methylcyclohexyl)oxyethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 55724268) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[2-(2-methylcyclohexyl)oxyethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(2-methylcyclohexyl)oxyethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 55724268 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[2-(2-methylcyclohexyl)oxyethyl]-2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1ccc(-c2nc(CC(=O)NCCOC3CCCCC3C)cs2)o1 |
| InChI | InChI=1S/C19H26N2O3S/c1-13-5-3-4-6-16(13)23-10-9-20-18(22)11-15-12-25-19(21-15)17-8-7-14(2)24-17/h7-8,12-13,16H,3-6,9-11H2,1-2H3,(H,20,22) |
| InChIKey | IJEDOPHVJMWDHP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|