C20H24N4O2S — CID 91642582
2-N-(2,6-dipyrrolidin-1-ylphenyl)thiophene-2,5-dicarboxamide (PubChem CID 91642582) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-N-(2,6-dipyrrolidin-1-ylphenyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-(2,6-dipyrrolidin-1-ylphenyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 91642582 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-N-(2,6-dipyrrolidin-1-ylphenyl)thiophene-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2c(N3CCCC3)cccc2N2CCCC2)s1 |
| InChI | InChI=1S/C20H24N4O2S/c21-19(25)16-8-9-17(27-16)20(26)22-18-14(23-10-1-2-11-23)6-5-7-15(18)24-12-3-4-13-24/h5-9H,1-4,10-13H2,(H2,21,25)(H,22,26) |
| InChIKey | GCPGSOWFYVPJQL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |