C15H11F3N4O2 — CID 91643504
7-(4-prop-2-enoxyphenoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 91643504) has the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. Its IUPAC name is 7-(4-prop-2-enoxyphenoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-(4-prop-2-enoxyphenoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 91643504 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 7-(4-prop-2-enoxyphenoxy)-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=CCOc1ccc(Oc2cc(C(F)(F)F)nc3ncnn23)cc1 |
| InChI | InChI=1S/C15H11F3N4O2/c1-2-7-23-10-3-5-11(6-4-10)24-13-8-12(15(16,17)18)21-14-19-9-20-22(13)14/h2-6,8-9H,1,7H2 |
| InChIKey | OUZLSMOOEOZFEV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|