C14H16F3N3O4 — CID 91644101
2-[(5-methyl-3-nitro-2-pyridinyl)oxy]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 91644101) has the molecular formula C14H16F3N3O4 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2-[(5-methyl-3-nitro-2-pyridinyl)oxy]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[(5-methyl-3-nitro-2-pyridinyl)oxy]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 91644101 |
| Molecular Formula | C14H16F3N3O4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[(5-methyl-3-nitro-2-pyridinyl)oxy]-1-[3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | Cc1cnc(OCC(=O)N2CCCC(C(F)(F)F)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16F3N3O4/c1-9-5-11(20(22)23)13(18-6-9)24-8-12(21)19-4-2-3-10(7-19)14(15,16)17/h5-6,10H,2-4,7-8H2,1H3 |
| InChIKey | OIBVANMVISVHAQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|