C16H21N5OS — CID 91644229
1-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 91644229) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 1-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 91644229 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[2-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | Cc1n[nH]c(=S)n1CCNC(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C16H21N5OS/c1-11-19-20-16(23)21(11)10-9-17-15(22)18-14-8-4-6-12-5-2-3-7-13(12)14/h4,6,8H,2-3,5,7,9-10H2,1H3,(H,20,23)(H2,17,18,22) |
| InChIKey | JMXFULDMMMVLED-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|