C19H22N2O4 — CID 91645333
piperidin-4-yl 3-[(5-ethylfuran-2-carbonyl)amino]benzoate (PubChem CID 91645333) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is piperidin-4-yl 3-[(5-ethylfuran-2-carbonyl)amino]benzoate.
| Compound Name | piperidin-4-yl 3-[(5-ethylfuran-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 91645333 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | piperidin-4-yl 3-[(5-ethylfuran-2-carbonyl)amino]benzoate |
| SMILES | CCc1ccc(C(=O)Nc2cccc(C(=O)OC3CCNCC3)c2)o1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-15-6-7-17(24-15)18(22)21-14-5-3-4-13(12-14)19(23)25-16-8-10-20-11-9-16/h3-7,12,16,20H,2,8-11H2,1H3,(H,21,22) |
| InChIKey | JAIWCAOONKGHTA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |