C27H26BrN3O4 — CID 166329576
piperidin-4-yl 3-[[2-[4-[(4-bromobenzoyl)amino]phenyl]acetyl]amino]benzoate (PubChem CID 166329576) has the molecular formula C27H26BrN3O4 and a molecular weight of 536.43 g/mol. Its IUPAC name is piperidin-4-yl 3-[[2-[4-[(4-bromobenzoyl)amino]phenyl]acetyl]amino]benzoate.
| Compound Name | piperidin-4-yl 3-[[2-[4-[(4-bromobenzoyl)amino]phenyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 166329576 |
| Molecular Formula | C27H26BrN3O4 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | piperidin-4-yl 3-[[2-[4-[(4-bromobenzoyl)amino]phenyl]acetyl]amino]benzoate |
| SMILES | O=C(Cc1ccc(NC(=O)c2ccc(Br)cc2)cc1)Nc1cccc(C(=O)OC2CCNCC2)c1 |
| InChI | InChI=1S/C27H26BrN3O4/c28-21-8-6-19(7-9-21)26(33)31-22-10-4-18(5-11-22)16-25(32)30-23-3-1-2-20(17-23)27(34)35-24-12-14-29-15-13-24/h1-11,17,24,29H,12-16H2,(H,30,32)(H,31,33) |
| InChIKey | QIOSTVRRQGCQGL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |