C20H17BrN4O3 — CID 166216918
4-[[3-[[2-(4-bromophenyl)acetyl]amino]benzoyl]amino]-1H-pyrrole-2-carboxamide (PubChem CID 166216918) has the molecular formula C20H17BrN4O3 and a molecular weight of 441.29 g/mol. Its IUPAC name is 4-[[3-[[2-(4-bromophenyl)acetyl]amino]benzoyl]amino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[[3-[[2-(4-bromophenyl)acetyl]amino]benzoyl]amino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 166216918 |
| Molecular Formula | C20H17BrN4O3 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 4-[[3-[[2-(4-bromophenyl)acetyl]amino]benzoyl]amino]-1H-pyrrole-2-carboxamide |
| SMILES | NC(=O)c1cc(NC(=O)c2cccc(NC(=O)Cc3ccc(Br)cc3)c2)c[nH]1 |
| InChI | InChI=1S/C20H17BrN4O3/c21-14-6-4-12(5-7-14)8-18(26)24-15-3-1-2-13(9-15)20(28)25-16-10-17(19(22)27)23-11-16/h1-7,9-11,23H,8H2,(H2,22,27)(H,24,26)(H,25,28) |
| InChIKey | OWAQOMWKRNMOKN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |