About 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride
2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride (PubChem CID 91647853) has the molecular formula C13H17Cl3N2O3
and a molecular weight of 355.65 g/mol. Its IUPAC name is 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride |
| PubChem CID | 91647853 |
| Molecular Formula | C13H17Cl3N2O3 |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride |
| SMILES | CC(C)(NCC(=O)NCC(=O)O)c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C13H16Cl2N2O3.ClH/c1-13(2,8-3-4-9(14)10(15)5-8)17-6-11(18)16-7-12(19)20;/h3-5,17H,6-7H2,1-2H3,(H,16,18)(H,19,20);1H |
| InChIKey | TXEAWLLQGXAQCB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride?
The IUPAC name of 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride (CID 91647853) is 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride.
What is the SMILES notation for 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride?
The canonical SMILES for 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride is CC(C)(NCC(=O)NCC(=O)O)c1ccc(Cl)c(Cl)c1.Cl.
What is the InChIKey of 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride?
The InChIKey is TXEAWLLQGXAQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2N2O3.ClH/c1-13(2,8-3-4-9(14)10(15)5-8)17-6-11(18)16-7-12(19)20;/h3-5,17H,6-7H2,1-2H3,(H,16,18)(H,19,20);1H.
What are the key properties of 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride?
2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride has a molecular weight of 355.65 g/mol, XLogP of 2.44, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[2-(3,4-dichlorophenyl)propan-2-ylamino]acetyl]amino]acetic acid;hydrochloride is sourced from PubChem (CID 91647853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).