C16H24N6O2 — CID 91648574
N'-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-N-(1-methylpyrazol-3-yl)oxamide (PubChem CID 91648574) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is N'-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-N-(1-methylpyrazol-3-yl)oxamide.
| Compound Name | N'-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-N-(1-methylpyrazol-3-yl)oxamide |
|---|---|
| PubChem CID | 91648574 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N'-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-N-(1-methylpyrazol-3-yl)oxamide |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)NC(=O)C(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C16H24N6O2/c1-10(12-9-22(16(3,4)5)19-11(12)2)17-14(23)15(24)18-13-7-8-21(6)20-13/h7-10H,1-6H3,(H,17,23)(H,18,20,24) |
| InChIKey | AVPCVRJJHWKGNJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|