C15H26N4O3 — CID 122010224
4-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylcarbamoylamino]butanoic acid (PubChem CID 122010224) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122010224 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 4-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethylcarbamoylamino]butanoic acid |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H26N4O3/c1-10(17-14(22)16-8-6-7-13(20)21)12-9-19(15(3,4)5)18-11(12)2/h9-10H,6-8H2,1-5H3,(H,20,21)(H2,16,17,22) |
| InChIKey | QKGSVZPEYVTBEG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|