C16H24N4OS — CID 75523892
1-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-3-(thiophen-3-ylmethyl)urea (PubChem CID 75523892) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-3-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-3-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 75523892 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-3-(thiophen-3-ylmethyl)urea |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)NC(=O)NCc1ccsc1 |
| InChI | InChI=1S/C16H24N4OS/c1-11(14-9-20(16(3,4)5)19-12(14)2)18-15(21)17-8-13-6-7-22-10-13/h6-7,9-11H,8H2,1-5H3,(H2,17,18,21) |
| InChIKey | YMDHKGVRQXSIFZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |