C18H23N5O2 — CID 91649825
3-phenyl-5-[[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]-1,3-oxazolidin-2-one (PubChem CID 91649825) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 3-phenyl-5-[[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-phenyl-5-[[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91649825 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-phenyl-5-[[1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]-1,3-oxazolidin-2-one |
| SMILES | CC(NCC1CN(c2ccccc2)C(=O)O1)c1nnc2n1CCCC2 |
| InChI | InChI=1S/C18H23N5O2/c1-13(17-21-20-16-9-5-6-10-22(16)17)19-11-15-12-23(18(24)25-15)14-7-3-2-4-8-14/h2-4,7-8,13,15,19H,5-6,9-12H2,1H3 |
| InChIKey | NIJPAVUFSNGMTA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |