C15H20N2O3 — CID 91650552
N'-ethyl-N-(2-methoxyphenyl)-N'-(2-methylprop-2-enyl)oxamide (PubChem CID 91650552) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-ethyl-N-(2-methoxyphenyl)-N'-(2-methylprop-2-enyl)oxamide.
| Compound Name | N'-ethyl-N-(2-methoxyphenyl)-N'-(2-methylprop-2-enyl)oxamide |
|---|---|
| PubChem CID | 91650552 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N'-ethyl-N-(2-methoxyphenyl)-N'-(2-methylprop-2-enyl)oxamide |
| SMILES | C=C(C)CN(CC)C(=O)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C15H20N2O3/c1-5-17(10-11(2)3)15(19)14(18)16-12-8-6-7-9-13(12)20-4/h6-9H,2,5,10H2,1,3-4H3,(H,16,18) |
| InChIKey | XZQNNAWHJOKSER-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|