C14H19N3O2 — CID 126832207
N'-ethyl-N'-(2-methylprop-2-enyl)-N-(3-methyl-4-pyridinyl)oxamide (PubChem CID 126832207) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N'-ethyl-N'-(2-methylprop-2-enyl)-N-(3-methyl-4-pyridinyl)oxamide.
| Compound Name | N'-ethyl-N'-(2-methylprop-2-enyl)-N-(3-methyl-4-pyridinyl)oxamide |
|---|---|
| PubChem CID | 126832207 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N'-ethyl-N'-(2-methylprop-2-enyl)-N-(3-methyl-4-pyridinyl)oxamide |
| SMILES | C=C(C)CN(CC)C(=O)C(=O)Nc1ccncc1C |
| InChI | InChI=1S/C14H19N3O2/c1-5-17(9-10(2)3)14(19)13(18)16-12-6-7-15-8-11(12)4/h6-8H,2,5,9H2,1,3-4H3,(H,15,16,18) |
| InChIKey | RSFWIXJTMCPRND-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|