C17H22N4O2S — CID 91651138
1-(2-ethylsulfonylphenyl)-4-pyridazin-3-yl-1,4-diazepane (PubChem CID 91651138) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 1-(2-ethylsulfonylphenyl)-4-pyridazin-3-yl-1,4-diazepane.
| Compound Name | 1-(2-ethylsulfonylphenyl)-4-pyridazin-3-yl-1,4-diazepane |
|---|---|
| PubChem CID | 91651138 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-(2-ethylsulfonylphenyl)-4-pyridazin-3-yl-1,4-diazepane |
| SMILES | CCS(=O)(=O)c1ccccc1N1CCCN(c2cccnn2)CC1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-24(22,23)16-8-4-3-7-15(16)20-11-6-12-21(14-13-20)17-9-5-10-18-19-17/h3-5,7-10H,2,6,11-14H2,1H3 |
| InChIKey | NECHFCBQJOASNY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |