C18H19N5O — CID 133457654
4-acetyl-3-(4-pyridazin-3-yl-1,4-diazepan-1-yl)benzonitrile (PubChem CID 133457654) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-acetyl-3-(4-pyridazin-3-yl-1,4-diazepan-1-yl)benzonitrile.
| Compound Name | 4-acetyl-3-(4-pyridazin-3-yl-1,4-diazepan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 133457654 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 4-acetyl-3-(4-pyridazin-3-yl-1,4-diazepan-1-yl)benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)cc1N1CCCN(c2cccnn2)CC1 |
| InChI | InChI=1S/C18H19N5O/c1-14(24)16-6-5-15(13-19)12-17(16)22-8-3-9-23(11-10-22)18-4-2-7-20-21-18/h2,4-7,12H,3,8-11H2,1H3 |
| InChIKey | LOCAWVMCCINLHD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |