About 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate
2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate (PubChem CID 91656034) has the molecular formula C12H12F2O4
and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate.
Molecular Properties
| Compound Name | 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate |
| PubChem CID | 91656034 |
| Molecular Formula | C12H12F2O4 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)OCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H12F2O4/c1-2-17-11(15)12(16)18-4-3-8-5-9(13)7-10(14)6-8/h5-7H,2-4H2,1H3 |
| InChIKey | IOMVHAUIUGGPJY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate?
The IUPAC name of 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate (CID 91656034) is 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate.
What is the SMILES notation for 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate?
The canonical SMILES for 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate is CCOC(=O)C(=O)OCCc1cc(F)cc(F)c1.
What is the InChIKey of 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate?
The InChIKey is IOMVHAUIUGGPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O4/c1-2-17-11(15)12(16)18-4-3-8-5-9(13)7-10(14)6-8/h5-7H,2-4H2,1H3.
What are the key properties of 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate?
2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate has a molecular weight of 258.22 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-(3,5-difluorophenyl)ethyl] 1-O-ethyl oxalate is sourced from PubChem (CID 91656034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).