C19H24ClN3 — CID 91672004
4-(4-benzylpiperazin-1-yl)-6-chloro-2,3-dimethylaniline (PubChem CID 91672004) has the molecular formula C19H24ClN3 and a molecular weight of 329.88 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-chloro-2,3-dimethylaniline.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-chloro-2,3-dimethylaniline |
|---|---|
| PubChem CID | 91672004 |
| Molecular Formula | C19H24ClN3 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-chloro-2,3-dimethylaniline |
| SMILES | Cc1c(N2CCN(Cc3ccccc3)CC2)cc(Cl)c(N)c1C |
| InChI | InChI=1S/C19H24ClN3/c1-14-15(2)19(21)17(20)12-18(14)23-10-8-22(9-11-23)13-16-6-4-3-5-7-16/h3-7,12H,8-11,13,21H2,1-2H3 |
| InChIKey | NJKJAWUSEAZFBO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|