C10H8BrNO3 — CID 91672852
4-bromo-5-(furan-2-yl)-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 91672852) has the molecular formula C10H8BrNO3 and a molecular weight of 270.08 g/mol. Its IUPAC name is 4-bromo-5-(furan-2-yl)-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-bromo-5-(furan-2-yl)-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 91672852 |
| Molecular Formula | C10H8BrNO3 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 4-bromo-5-(furan-2-yl)-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]c(-c2ccco2)c(Br)c1C(=O)O |
| InChI | InChI=1S/C10H8BrNO3/c1-5-7(10(13)14)8(11)9(12-5)6-3-2-4-15-6/h2-4,12H,1H3,(H,13,14) |
| InChIKey | KFWPGOOZPCARMO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |