C17H12Cl2N2O2 — CID 91673727
prop-2-enyl 2-(2,5-dichlorophenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 91673727) has the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.20 g/mol. Its IUPAC name is prop-2-enyl 2-(2,5-dichlorophenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-(2,5-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 91673727 |
| Molecular Formula | C17H12Cl2N2O2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | prop-2-enyl 2-(2,5-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2nc(-c3cc(Cl)ccc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C17H12Cl2N2O2/c1-2-7-23-17(22)10-3-6-14-15(8-10)21-16(20-14)12-9-11(18)4-5-13(12)19/h2-6,8-9H,1,7H2,(H,20,21) |
| InChIKey | IWQASYUAZDIEEI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|