C17H11Cl3N2O2 — CID 91686800
prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 91686800) has the molecular formula C17H11Cl3N2O2 and a molecular weight of 381.65 g/mol. Its IUPAC name is prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 91686800 |
| Molecular Formula | C17H11Cl3N2O2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1cc(Cl)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C17H11Cl3N2O2/c1-2-5-24-17(23)10-7-13(20)15-14(8-10)21-16(22-15)9-3-4-11(18)12(19)6-9/h2-4,6-8H,1,5H2,(H,21,22) |
| InChIKey | XHLMEUXUPUJLFI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|