About prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate
prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 91686800) has the molecular formula C17H11Cl3N2O2
and a molecular weight of 381.65 g/mol. Its IUPAC name is prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
| PubChem CID | 91686800 |
| Molecular Formula | C17H11Cl3N2O2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1cc(Cl)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C17H11Cl3N2O2/c1-2-5-24-17(23)10-7-13(20)15-14(8-10)21-16(22-15)9-3-4-11(18)12(19)6-9/h2-4,6-8H,1,5H2,(H,21,22) |
| InChIKey | XHLMEUXUPUJLFI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
The IUPAC name of prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate (CID 91686800) is prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate.
What is the SMILES notation for prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
The canonical SMILES for prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate is C=CCOC(=O)c1cc(Cl)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1.
What is the InChIKey of prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
The InChIKey is XHLMEUXUPUJLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl3N2O2/c1-2-5-24-17(23)10-7-13(20)15-14(8-10)21-16(22-15)9-3-4-11(18)12(19)6-9/h2-4,6-8H,1,5H2,(H,21,22).
What are the key properties of prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate?
prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate has a molecular weight of 381.65 g/mol, XLogP of 5.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 7-chloro-2-(3,4-dichlorophenyl)-3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 91686800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).