C20H25N3O2 — CID 91677207
prop-2-enyl 2-(4-ethylpiperazin-1-yl)-5-pyrrol-1-ylbenzoate (PubChem CID 91677207) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is prop-2-enyl 2-(4-ethylpiperazin-1-yl)-5-pyrrol-1-ylbenzoate.
| Compound Name | prop-2-enyl 2-(4-ethylpiperazin-1-yl)-5-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 91677207 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | prop-2-enyl 2-(4-ethylpiperazin-1-yl)-5-pyrrol-1-ylbenzoate |
| SMILES | C=CCOC(=O)c1cc(-n2cccc2)ccc1N1CCN(CC)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-3-15-25-20(24)18-16-17(22-9-5-6-10-22)7-8-19(18)23-13-11-21(4-2)12-14-23/h3,5-10,16H,1,4,11-15H2,2H3 |
| InChIKey | IVPHPUKFLJLIQA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|