C8H5BrN4O3 — CID 91679021
2-bromo-4-nitro-6-(1,2,4-triazol-4-yl)phenol (PubChem CID 91679021) has the molecular formula C8H5BrN4O3 and a molecular weight of 285.06 g/mol. Its IUPAC name is 2-bromo-4-nitro-6-(1,2,4-triazol-4-yl)phenol.
| Compound Name | 2-bromo-4-nitro-6-(1,2,4-triazol-4-yl)phenol |
|---|---|
| PubChem CID | 91679021 |
| Molecular Formula | C8H5BrN4O3 |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 2-bromo-4-nitro-6-(1,2,4-triazol-4-yl)phenol |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C8H5BrN4O3/c9-6-1-5(13(15)16)2-7(8(6)14)12-3-10-11-4-12/h1-4,14H |
| InChIKey | WXTLXYZXISAJGG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|