methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate

C16H14Br2O4 — CID 91679930

IUPACmethyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate
SMILESCOC(=O)c1cc(Br)c(OCc2ccc(Br)cc2)c(OC)c1
InChIInChI=1S/C16H14Br2O4/c1-20-14-8-11(16(19)21-2)7-13(18)15(14)22-9-10-3-5-12(17)6-4-10/h3-8H,9H2,1-2H3
InChIKeyWQZMDMLRTTYCIH-UHFFFAOYSA-N
MW430.09 g/mol
LogP4.59
Rot. Bonds5

About methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate

methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate (PubChem CID 91679930) has the molecular formula C16H14Br2O4 and a molecular weight of 430.09 g/mol. Its IUPAC name is methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate
PubChem CID91679930
Molecular FormulaC16H14Br2O4
Molecular Weight430.09 g/mol
Exact Mass427.93
IUPAC Namemethyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate
SMILESCOC(=O)c1cc(Br)c(OCc2ccc(Br)cc2)c(OC)c1
InChIInChI=1S/C16H14Br2O4/c1-20-14-8-11(16(19)21-2)7-13(18)15(14)22-9-10-3-5-12(17)6-4-10/h3-8H,9H2,1-2H3
InChIKeyWQZMDMLRTTYCIH-UHFFFAOYSA-N
XLogP4.59
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500430.09
LogP ≤ 54.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate?
The IUPAC name of methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate (CID 91679930) is methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate.
What is the SMILES notation for methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate?
The canonical SMILES for methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate is COC(=O)c1cc(Br)c(OCc2ccc(Br)cc2)c(OC)c1.
What is the InChIKey of methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate?
The InChIKey is WQZMDMLRTTYCIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Br2O4/c1-20-14-8-11(16(19)21-2)7-13(18)15(14)22-9-10-3-5-12(17)6-4-10/h3-8H,9H2,1-2H3.
What are the key properties of methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate?
methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate has a molecular weight of 430.09 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[(4-bromophenyl)methoxy]-5-methoxybenzoate is sourced from PubChem (CID 91679930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).