C18H18IN3O3 — CID 91682125
5-[3-ethoxy-5-iodo-4-[(2-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 91682125) has the molecular formula C18H18IN3O3 and a molecular weight of 451.26 g/mol. Its IUPAC name is 5-[3-ethoxy-5-iodo-4-[(2-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[3-ethoxy-5-iodo-4-[(2-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 91682125 |
| Molecular Formula | C18H18IN3O3 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | 5-[3-ethoxy-5-iodo-4-[(2-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCOc1cc(-c2nnc(N)o2)cc(I)c1OCc1ccccc1C |
| InChI | InChI=1S/C18H18IN3O3/c1-3-23-15-9-13(17-21-22-18(20)25-17)8-14(19)16(15)24-10-12-7-5-4-6-11(12)2/h4-9H,3,10H2,1-2H3,(H2,20,22) |
| InChIKey | KLZVZQUMTVSUSD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|