C17H14ClFIN3O3 — CID 91682150
5-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 91682150) has the molecular formula C17H14ClFIN3O3 and a molecular weight of 489.67 g/mol. Its IUPAC name is 5-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 91682150 |
| Molecular Formula | C17H14ClFIN3O3 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | 5-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCOc1cc(-c2nnc(N)o2)cc(I)c1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H14ClFIN3O3/c1-2-24-14-6-10(16-22-23-17(21)26-16)5-13(20)15(14)25-8-9-3-4-11(19)7-12(9)18/h3-7H,2,8H2,1H3,(H2,21,23) |
| InChIKey | DIZWTWXGJFWAFX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|