C19H17IN2O3 — CID 91683229
3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)benzohydrazide (PubChem CID 91683229) has the molecular formula C19H17IN2O3 and a molecular weight of 448.26 g/mol. Its IUPAC name is 3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)benzohydrazide.
| Compound Name | 3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)benzohydrazide |
|---|---|
| PubChem CID | 91683229 |
| Molecular Formula | C19H17IN2O3 |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)benzohydrazide |
| SMILES | COc1cc(C(=O)NN)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C19H17IN2O3/c1-24-17-10-14(19(23)22-21)9-16(20)18(17)25-11-13-7-4-6-12-5-2-3-8-15(12)13/h2-10H,11,21H2,1H3,(H,22,23) |
| InChIKey | WTLFQHOTGUDPLG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|