C24H33N3O — CID 91683980
N-[2-amino-4-methyl-5-(3-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide (PubChem CID 91683980) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is N-[2-amino-4-methyl-5-(3-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide.
| Compound Name | N-[2-amino-4-methyl-5-(3-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 91683980 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | N-[2-amino-4-methyl-5-(3-methylpiperidin-1-yl)phenyl]-4-tert-butylbenzamide |
| SMILES | Cc1cc(N)c(NC(=O)c2ccc(C(C)(C)C)cc2)cc1N1CCCC(C)C1 |
| InChI | InChI=1S/C24H33N3O/c1-16-7-6-12-27(15-16)22-14-21(20(25)13-17(22)2)26-23(28)18-8-10-19(11-9-18)24(3,4)5/h8-11,13-14,16H,6-7,12,15,25H2,1-5H3,(H,26,28) |
| InChIKey | TXBOSBVQJQFLRK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|