C22H29N3O — CID 91683959
N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2-methylbenzamide (PubChem CID 91683959) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2-methylbenzamide.
| Compound Name | N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 91683959 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cc(N2CC(C)CC(C)C2)c(C)cc1N |
| InChI | InChI=1S/C22H29N3O/c1-14-9-15(2)13-25(12-14)21-11-20(19(23)10-17(21)4)24-22(26)18-8-6-5-7-16(18)3/h5-8,10-11,14-15H,9,12-13,23H2,1-4H3,(H,24,26) |
| InChIKey | WUQMNXDSSCVRBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|