C22H28BrN3O — CID 100805211
5-amino-N-(4-bromo-2,6-dimethylphenyl)-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzamide (PubChem CID 100805211) has the molecular formula C22H28BrN3O and a molecular weight of 430.39 g/mol. Its IUPAC name is 5-amino-N-(4-bromo-2,6-dimethylphenyl)-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzamide.
| Compound Name | 5-amino-N-(4-bromo-2,6-dimethylphenyl)-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 100805211 |
| Molecular Formula | C22H28BrN3O |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 5-amino-N-(4-bromo-2,6-dimethylphenyl)-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)c1cc(N)ccc1N1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C22H28BrN3O/c1-13-7-14(2)12-26(11-13)20-6-5-18(24)10-19(20)22(27)25-21-15(3)8-17(23)9-16(21)4/h5-6,8-10,13-14H,7,11-12,24H2,1-4H3,(H,25,27)/t13-,14-/m1/s1 |
| InChIKey | AVQPOMQYUQXGJW-ZIAGYGMSSA-N |
| XLogP | 5.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|