C19H31N3O — CID 91683936
N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2,2-dimethylpropanamide (PubChem CID 91683936) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 91683936 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | N-[2-amino-5-(3,5-dimethylpiperidin-1-yl)-4-methylphenyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(N)c(NC(=O)C(C)(C)C)cc1N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C19H31N3O/c1-12-7-13(2)11-22(10-12)17-9-16(15(20)8-14(17)3)21-18(23)19(4,5)6/h8-9,12-13H,7,10-11,20H2,1-6H3,(H,21,23) |
| InChIKey | NGCUYMKHNHTWJO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|