C22H29N3O2 — CID 100805564
N-[2-amino-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-2-methoxybenzamide (PubChem CID 100805564) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[2-amino-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-2-methoxybenzamide.
| Compound Name | N-[2-amino-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 100805564 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-[2-amino-5-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1cc(N2[C@H](C)CCC[C@H]2C)c(C)cc1N |
| InChI | InChI=1S/C22H29N3O2/c1-14-12-18(23)19(13-20(14)25-15(2)8-7-9-16(25)3)24-22(26)17-10-5-6-11-21(17)27-4/h5-6,10-13,15-16H,7-9,23H2,1-4H3,(H,24,26)/t15-,16-/m1/s1 |
| InChIKey | KGFFUIZBXVHVQJ-HZPDHXFCSA-N |
| XLogP | 4.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|