C23H31N3O3 — CID 100805539
N-[2-amino-5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-3,4-dimethoxybenzamide (PubChem CID 100805539) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-amino-5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-amino-5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 100805539 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[2-amino-5-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-4-methylphenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(N3[C@@H](C)CCC[C@@H]3C)c(C)cc2N)cc1OC |
| InChI | InChI=1S/C23H31N3O3/c1-14-11-18(24)19(13-20(14)26-15(2)7-6-8-16(26)3)25-23(27)17-9-10-21(28-4)22(12-17)29-5/h9-13,15-16H,6-8,24H2,1-5H3,(H,25,27)/t15-,16-/m0/s1 |
| InChIKey | BZUARQQNBUEWMX-HOTGVXAUSA-N |
| XLogP | 4.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|