C19H16BrIO3 — CID 91684856
prop-2-enyl (E)-3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]prop-2-enoate (PubChem CID 91684856) has the molecular formula C19H16BrIO3 and a molecular weight of 499.14 g/mol. Its IUPAC name is prop-2-enyl (E)-3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]prop-2-enoate.
| Compound Name | prop-2-enyl (E)-3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91684856 |
| Molecular Formula | C19H16BrIO3 |
| Molecular Weight | 499.14 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | prop-2-enyl (E)-3-[4-[(4-bromophenyl)methoxy]-3-iodophenyl]prop-2-enoate |
| SMILES | C=CCOC(=O)/C=C/c1ccc(OCc2ccc(Br)cc2)c(I)c1 |
| InChI | InChI=1S/C19H16BrIO3/c1-2-11-23-19(22)10-6-14-5-9-18(17(21)12-14)24-13-15-3-7-16(20)8-4-15/h2-10,12H,1,11,13H2/b10-6+ |
| InChIKey | LPXOSZWSDFPADZ-UXBLZVDNSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.14 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|