C16H14IN3O4 — CID 91684890
(E)-3-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enehydrazide (PubChem CID 91684890) has the molecular formula C16H14IN3O4 and a molecular weight of 439.21 g/mol. Its IUPAC name is (E)-3-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enehydrazide.
| Compound Name | (E)-3-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 91684890 |
| Molecular Formula | C16H14IN3O4 |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | (E)-3-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enehydrazide |
| SMILES | NNC(=O)/C=C/c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(I)c1 |
| InChI | InChI=1S/C16H14IN3O4/c17-14-9-11(4-8-16(21)19-18)3-7-15(14)24-10-12-1-5-13(6-2-12)20(22)23/h1-9H,10,18H2,(H,19,21)/b8-4+ |
| InChIKey | DGEMTNOKGMCBSD-XBXARRHUSA-N |
| XLogP | 2.78 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|