C16H13ClFIN2O2 — CID 91684841
(E)-3-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-iodophenyl]prop-2-enehydrazide (PubChem CID 91684841) has the molecular formula C16H13ClFIN2O2 and a molecular weight of 446.65 g/mol. Its IUPAC name is (E)-3-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-iodophenyl]prop-2-enehydrazide.
| Compound Name | (E)-3-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-iodophenyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 91684841 |
| Molecular Formula | C16H13ClFIN2O2 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | (E)-3-[4-[(2-chloro-4-fluorophenyl)methoxy]-3-iodophenyl]prop-2-enehydrazide |
| SMILES | NNC(=O)/C=C/c1ccc(OCc2ccc(F)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C16H13ClFIN2O2/c17-13-8-12(18)4-3-11(13)9-23-15-5-1-10(7-14(15)19)2-6-16(22)21-20/h1-8H,9,20H2,(H,21,22)/b6-2+ |
| InChIKey | FCJJXPWCQBQKMU-QHHAFSJGSA-N |
| XLogP | 3.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|