C23H17IO3 — CID 91684919
prop-2-ynyl (E)-3-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enoate (PubChem CID 91684919) has the molecular formula C23H17IO3 and a molecular weight of 468.29 g/mol. Its IUPAC name is prop-2-ynyl (E)-3-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enoate.
| Compound Name | prop-2-ynyl (E)-3-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91684919 |
| Molecular Formula | C23H17IO3 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | prop-2-ynyl (E)-3-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enoate |
| SMILES | C#CCOC(=O)/C=C/c1ccc(OCc2cccc3ccccc23)c(I)c1 |
| InChI | InChI=1S/C23H17IO3/c1-2-14-26-23(25)13-11-17-10-12-22(21(24)15-17)27-16-19-8-5-7-18-6-3-4-9-20(18)19/h1,3-13,15H,14,16H2/b13-11+ |
| InChIKey | QQVTYZFWHFAJOG-ACCUITESSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|