C19H14BrFO3 — CID 91684679
prop-2-ynyl (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 91684679) has the molecular formula C19H14BrFO3 and a molecular weight of 389.22 g/mol. Its IUPAC name is prop-2-ynyl (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | prop-2-ynyl (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91684679 |
| Molecular Formula | C19H14BrFO3 |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | prop-2-ynyl (E)-3-[3-bromo-4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | C#CCOC(=O)/C=C/c1ccc(OCc2ccccc2F)c(Br)c1 |
| InChI | InChI=1S/C19H14BrFO3/c1-2-11-23-19(22)10-8-14-7-9-18(16(20)12-14)24-13-15-5-3-4-6-17(15)21/h1,3-10,12H,11,13H2/b10-8+ |
| InChIKey | PQQBOLZITNGSMX-CSKARUKUSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|