C26H20IN3O4 — CID 126375610
N-[(E)-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 126375610) has the molecular formula C26H20IN3O4 and a molecular weight of 565.37 g/mol. Its IUPAC name is N-[(E)-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126375610 |
| Molecular Formula | C26H20IN3O4 |
| Molecular Weight | 565.37 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | N-[(E)-[3-iodo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])N/N=C/c1ccc(OCc2cccc3ccccc23)c(I)c1 |
| InChI | InChI=1S/C26H20IN3O4/c27-23-14-18(16-28-29-26(31)15-20-7-2-4-11-24(20)30(32)33)12-13-25(23)34-17-21-9-5-8-19-6-1-3-10-22(19)21/h1-14,16H,15,17H2,(H,29,31)/b28-16+ |
| InChIKey | AZBPCKABVVPQJM-LQKURTRISA-N |
| XLogP | 5.62 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|