C23H20IN3O4 — CID 126377996
N-[(E)-[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 126377996) has the molecular formula C23H20IN3O4 and a molecular weight of 529.33 g/mol. Its IUPAC name is N-[(E)-[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126377996 |
| Molecular Formula | C23H20IN3O4 |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | N-[(E)-[3-iodo-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | Cc1cccc(COc2ccc(/C=N/NC(=O)Cc3ccccc3[N+](=O)[O-])cc2I)c1 |
| InChI | InChI=1S/C23H20IN3O4/c1-16-5-4-6-18(11-16)15-31-22-10-9-17(12-20(22)24)14-25-26-23(28)13-19-7-2-3-8-21(19)27(29)30/h2-12,14H,13,15H2,1H3,(H,26,28)/b25-14+ |
| InChIKey | QWBYCBPWLOWVGS-AFUMVMLFSA-N |
| XLogP | 4.78 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|