C17H17BrN2O4S — CID 91687877
5-[2-bromo-4-(pentanoylcarbamothioylamino)phenyl]furan-2-carboxylic acid (PubChem CID 91687877) has the molecular formula C17H17BrN2O4S and a molecular weight of 425.30 g/mol. Its IUPAC name is 5-[2-bromo-4-(pentanoylcarbamothioylamino)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-bromo-4-(pentanoylcarbamothioylamino)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 91687877 |
| Molecular Formula | C17H17BrN2O4S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 5-[2-bromo-4-(pentanoylcarbamothioylamino)phenyl]furan-2-carboxylic acid |
| SMILES | CCCCC(=O)NC(=S)Nc1ccc(-c2ccc(C(=O)O)o2)c(Br)c1 |
| InChI | InChI=1S/C17H17BrN2O4S/c1-2-3-4-15(21)20-17(25)19-10-5-6-11(12(18)9-10)13-7-8-14(24-13)16(22)23/h5-9H,2-4H2,1H3,(H,22,23)(H2,19,20,21,25) |
| InChIKey | FXRWHISXUMRHIK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|