C16H8Br2O4 — CID 91688743
3,5-dibromo-2-(2-oxochromen-3-yl)benzoic acid (PubChem CID 91688743) has the molecular formula C16H8Br2O4 and a molecular weight of 424.04 g/mol. Its IUPAC name is 3,5-dibromo-2-(2-oxochromen-3-yl)benzoic acid.
| Compound Name | 3,5-dibromo-2-(2-oxochromen-3-yl)benzoic acid |
|---|---|
| PubChem CID | 91688743 |
| Molecular Formula | C16H8Br2O4 |
| Molecular Weight | 424.04 g/mol |
| Exact Mass | 421.88 |
| IUPAC Name | 3,5-dibromo-2-(2-oxochromen-3-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(Br)c1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C16H8Br2O4/c17-9-6-10(15(19)20)14(12(18)7-9)11-5-8-3-1-2-4-13(8)22-16(11)21/h1-7H,(H,19,20) |
| InChIKey | XVNKGSMKKYVSGR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.04 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|