C15H22F7NO3S — CID 91691542
4-methylpentyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate (PubChem CID 91691542) has the molecular formula C15H22F7NO3S and a molecular weight of 429.40 g/mol. Its IUPAC name is 4-methylpentyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate.
| Compound Name | 4-methylpentyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91691542 |
| Molecular Formula | C15H22F7NO3S |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 4-methylpentyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCC(C)C |
| InChI | InChI=1S/C15H22F7NO3S/c1-9(2)5-4-7-26-11(24)10(6-8-27-3)23-12(25)13(16,17)14(18,19)15(20,21)22/h9-10H,4-8H2,1-3H3,(H,23,25) |
| InChIKey | PPYXFSQWZOAGNC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|