C6H7ClF3NO2 — CID 91691571
N-acetyl-N-(2-chloroethyl)-2,2,2-trifluoroacetamide (PubChem CID 91691571) has the molecular formula C6H7ClF3NO2 and a molecular weight of 217.57 g/mol. Its IUPAC name is N-acetyl-N-(2-chloroethyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-acetyl-N-(2-chloroethyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91691571 |
| Molecular Formula | C6H7ClF3NO2 |
| Molecular Weight | 217.57 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | N-acetyl-N-(2-chloroethyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)N(CCCl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H7ClF3NO2/c1-4(12)11(3-2-7)5(13)6(8,9)10/h2-3H2,1H3 |
| InChIKey | SJWJNUMFBKXQTI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.57 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|