C11H17BO7 — CID 91691762
[(3aS,4R,6R,6aR)-4-acetyloxy-2-ethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methyl acetate (PubChem CID 91691762) has the molecular formula C11H17BO7 and a molecular weight of 272.06 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-acetyloxy-2-ethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methyl acetate.
| Compound Name | [(3aS,4R,6R,6aR)-4-acetyloxy-2-ethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91691762 |
| Molecular Formula | C11H17BO7 |
| Molecular Weight | 272.06 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-acetyloxy-2-ethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaborol-6-yl]methyl acetate |
| SMILES | CCB1O[C@@H]2[C@@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C11H17BO7/c1-4-12-18-9-8(5-15-6(2)13)17-11(10(9)19-12)16-7(3)14/h8-11H,4-5H2,1-3H3/t8-,9+,10+,11+/m1/s1 |
| InChIKey | SEBDNDWISCNEGT-RCWTZXSCSA-N |
| XLogP | 0.13 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.06 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|